1Medium10 marks
Derive Langmuir adsorption isotherm. How does Langmuir adsorption isotherm help in elucidation of kinetics of a gaseous reaction on solid surface?
Loading page, please wait…
122 questions from the UPSC 2022 examination.
122 questions
Derive Langmuir adsorption isotherm. How does Langmuir adsorption isotherm help in elucidation of kinetics of a gaseous reaction on solid surface?
(1) A compound with MF C2H2BrCl exhibits two doublets (J = 16 Hz) in its PMR spectrum. Suggest a suitable structure along with other possible structures. (2) How can the structures of A and B be decided based on their UV spectral data? [lambda max = 296 nm (epsilon max = 10700) and lambda max = 281 nm (epsilon max = 20800)] [Structures A and B shown]
The compound A, acetal of acetaldehyde, on reaction with B, under given reaction conditions, yields C and the final product D : [Reaction scheme shown with A + B -> Propionic acid -> C -> Delta -> D] (i) Write down the structures of the products C and D. Propose a mechanism with suitable explanation. (ii) Write down the product(s) if ortho-ester E is used instead of the compound A under the similar reaction conditions : [Structure E given]
Predict the products X and Y in the following reactions : (i) HO-[structure] -> (1) O3, (2) H2O2 -> X + Y (ii) [structure with COOH] -> PBr3, Br2 (57%) -> X (iii) CH3-CH-CH3 -> Br2/hv, 127 °C -> X + Y
By using the following given data, find that under what conditions is H2 in the state corresponding to N2 at 126 K and 1 atm? Gas | T_c/K | P_c/atm H2 | 33 | 13 N2 | 126 | 39
For a cell reaction Cu^2+(aq) + Zn(s) -> Cu(s) + Zn^2+(aq) the standard electrode potential for Zn/Zn^2+ = 0.339 V and for Cu^2+/Cu = 0.762 V at 25°C. Calculate standard change in free energy \Delta G^0 and equilibrium constant K for the reaction. [R = 8.314 J mol^-1 K^-1]
A particle is in the n-th energy state, \phi_n(x), of an infinite square well potential with width L (box size from 0 to L). Calculate the probability that the particle is confined to the first 1/a of the width of the well.
Provide briefly a qualitative account of different forces which influence the speed of an ion in solution of strong electrolyte moving under an externally applied electric field.
If more than one equivalent of Br2 at high temperature are allowed to react with cyclopentane, how many dibromocyclopentanes would you expect as products? Draw their structures and name them.
Write the structures of the products X, Y and Z in the following reactions and indicate the mechanism for the formation of X : [Image of reaction sequence with OsO4, Pyridine, H+, H2O, HIO4 yielding Y + Z]
The compound A is optically active and upon treating A with alcoholic sodium ethoxide, it looses its optical activity. Justify : [Image of compound A]
(i) How XeF_6 can be separated from a mixture of XeF_2, XeF_4 and XeF_6? (ii) Write the products with explanation B_2H_6 + 2NH_3 -> ? B_2H_6 + 2Me_3N -> ?
What is McLafferty rearrangement? Discuss the mass spectral fragmentation of butyl butyrate with the following given data of ions : m/z 101, m/z 73, m/z 71 and m/z 56 Write the structures of fragment ions.
Write the major and minor products in the following reaction. Discuss the stereochemistry along with reaction mechanism for the formation of the major product : [Image of reaction with m-CPBA yielding ? (major product) + ? (minor product)]
The reaction cis-2-butene <-> trans-2-butene is first order in both the direction. At 25°C, the equilibrium constant is 0.406 and the forward reaction rate constant is 4.21 x 10^-4 sec^-1. Starting with a sample of pure cis isomer with [cis]0 = 0.115 mol dm^-3, how long it will take to form half of equilibrium amount of the trans isomer from cis isomer?
Define stationary and non-stationary (branching) chain reaction. Non-stationary chain reactions always lead to explosion under certain conditions. Give a detailed account of these conditions.
Complete the following reactions and give suitable mechanisms for the formation of products : (i) CH3-CH2-CH2-Cl -> (1) 2NaBH4, (2) H3O+ -> ? (ii) CH3-C=C-CH3 -> Na in liq. NH3 -> ?
Ionization of 3,4-dichloro-1,2,3,4-tetramethylcyclobutene in SbF5-SO2 at -75 °C produces a reaction intermediate of its own kind. Predict the intermediate and comment on its stability and aromaticity.
Among the following compounds I and II, which has more carbonyl stretching frequency in IR spectra? Explain : [Images of compounds I and II]
Consider the above pairs of \pi-donor ligands: Identify the d^6 metal ions/atom among Co(O), Mn(I), Fe(II), and Fe(III), which form neutral mixed sandwich compound. Explain.
Complete the following reaction. Write the structures of A, B and C, and explain how IR spectroscopy is helpful to distinguish among them : [Image of reaction involving a cyclic alcohol + H+ -> A + B + C]
Arrange the following compounds in order of their increasing reactivity towards nucleophilic substitution through SN2 mechanism. Assign the reason for the same also : [Images of compounds A, B, C, D]
At 0°C and 1 atm pressure, the volume of nitrogen gas required to cover a sample of an adsorbent is found to be 130 cm^3 g^-1. Calculate the surface area per gram of adsorbent. Given that area occupied by a nitrogen molecule is 0.162 (nm)^2. [N_A = 6.022 x 10^23 mol^-1]
Label each of the following processes with proper explanation in Jablonski diagram : (A) Allowed absorption (B) Fluorescence (C) Phosphorescence (D) Internal Conversion (IC) (E) Inter System Crossing (ISC) Discuss the mode of transition which is favourable for a photochemical reaction.
How will you distinguish between NH stretching absorption of a primary amine and a secondary amine by using IR spectroscopy?
Predict [A] and [B] in the following reaction : [Image of naphthalene system] --NBS/CCl4--> [A] --NaOEt/EtOH/delta--> [B]
Write down the structure(s) of the product(s) obtained in the following reactions. Provide suitable justification and propose the mechanisms : (i) C6H5-CH(OH)-CH(OH)-CH3 -> (H+, Delta) (ii) C6H5-C(CH3)(OH)-C(CH3)(OH)-C6H5 -> (H+, Delta)
A particle is in the nth energy state, phi_n(x), of an infinite square well potential with width L (box size from 0 to L). Calculate the probability that the particle is confined to the first 1/a of the width of the well.
Write the reaction sequence for the synthesis of L-dopa(B), a drug for the treatment of Parkinson's disease, from L-tyrosine (A), an alpha-amino acid : [Image of structures of L-tyrosine (A) and L-dopa (B)]
A 74.6 g ice cube floats in the sea. The temperature and pressure of the system and surroundings are 0°C and 1 atm. Calculate \Delta S_{syst}, \Delta S_{surr} and \Delta S_{univ} for the melting of ice cube. What can you conclude about the nature of process from the value of \Delta S_{univ}? (The molar heat of fusion of water is 6.01 kJ/mol)
Predict the structures of X and Y, and also mention the major product : [Image: Chemical reaction of 4-nitrobenzyl with a diazo/aziridine-like structure yielding X + Y via MeO-/MeOH]
How is Perlon synthesized from epsilon-Caprolactam? Give the mechanism of the reaction.
Write the structures of nucleosides and nucleotides, and discuss the primary structures of DNA and RNA.
Predict the product(s) formed on heating the cyclopentadiene and provide a suitable justification to your answer.
Predict the structures of X and Y, and also mention the major product : [Reaction Diagram showing O2N group on a bicyclic/fused system reacting with MeO-/MeOH to give X + Y]
By using appropriate reactants, reagents and conditions and using acetylene as starting material, how will you synthesize the following compound? [Image of bicyclic alcohol structure]
The vapour pressure of water at 363.2 K is 529 torr. Use the Clausius-Clapeyron equation to determine the average value of molar heat of vaporization, \Delta H, of water between 363.2 K and 373.2 K. [R = 8.314 J mol^-1 K^-1]
The graph above shows the distribution of molecular speeds for Argon and Helium at the same temperature. (i) Which curve, 1 or 2 better represents the behavior of Argon? (ii) Which curve represents the gas that effuses more slowly? (iii) Which curve more closely represents the behavior of fluorine gas? Explain.
At 0°C and 1 atm pressure, the volume of nitrogen gas required to cover a sample of an adsorbent is found to be 130 cm^3 g^-1. Calculate the surface area per gram of adsorbent. Given that area occupied by a nitrogen molecule is 0.162 (nm)^2. [N_A = 6.022 * 10^23 mol^-1]
Considering the structural features of ergosterol (A) and precalciferol (B), a precursor of vitamin D, giving mechanistic details, explain why vitamin D deficiency is endemic in those parts of the world where sunlight is scarce : [Image of ergosterol (A) and precalciferol (B)]
Consider aqueous solutions of LaCl3 (Lanthanum trichloride) and LuCl3 (Lutetium trichloride). Which solution shows lower pH ? Explain.
Consider two liquids A and B such that A has half of the surface tension and twice the density of B. If liquid A rises to a height of 2.0 cm in a capillary, what will be the height to which liquid B will rise in the same capillary.
Consider aqueous solutions of LaCl_3 (Lanthanum trichloride) and LuCl_3 (Lutetium trichloride). Which solution shows lower pH? Explain.
What happens when the compound A is heated with one equivalent of HI ? Give the structure of the product. Justify your answer : [Image of compound A - cyclic ether with CH3 groups]
A compound (A) containing C, H and O has molecular weight 102 and displays two signals in the 1H NMR spectrum at delta 1.1 (d) and 3.55 (septet) in the integral ratio of 6 : 1. Treatment of A with 1 mole of HI gives rise to B and C. In the IR spectrum, B gives a strong absorption band at 3300 cm^-1, whereas its 1H NMR spectrum shows signals at delta 1.05 (d, 6H), 3.6 (septet, 1H) and 4.4 (s, 1H, disappeared with D2O). The 1H NMR spectrum of C gives signals at delta 1.9 (d, 6H) and 4.25 (septet, 1H). Reaction of A with excess of HI gives only C. Identify A, B and C. Write all the reactions involved.
Write down the structure(s) of the product(s) obtained in the following reactions. Provide suitable justification and propose the mechanisms : (i) C6H5-CH(OH)-CH(CH3)-OH + H+, delta -> (ii) C6H5-C(OH)(CH3)-C(OH)(CH3)-C6H5 + H+, delta ->
Explain why 1,3-butadiene exhibits a lower lambda max for pi -> pi* transitions compared to that of 1,3,5-hexatriene.
Match the following for the synthesis of class of compounds listed in Set-I with the reactants and reagents of Set-II : Set-I (A) Quinoline (B) Isoquinoline (C) Indole Set-II (1) Cinnamaldehyde, hydroxylamine, P2O5 (2) Acetaldehyde, phenylhydrazine, acid (3) Glycerol, aniline, acid, nitrobenzene (4) alpha-Halocarbonyl compound, thiourea Propose the mechanism for the synthesis of indole.
Calculate the lambda max values of the following compounds : [Structures (1) and (2) given]
Considering the structural features of ergosterol (A) and precalciferol (B), a precursor of vitamin D, giving mechanistic details, explain why vitamin D deficiency is endemic in those parts of the world where sunlight is scarce : [Structures A and B given]
Arrange the following compounds in order of their increasing reactivity towards nucleophilic substitution through SN2 mechanism. Assign the reason for the same also : [Structures A, B, C, D given]
An automobile tyre contains air at 320 * 10^3 Pa at 20°C. The stem valve is removed and the air is allowed to expand adiabatically against a constant external pressure of 100 * 10^3 Pa until P = P_external. For air, C_{v,m} = 5/2 R. Calculate the final temperature of the gas in the tyre. Assume ideal gas behaviour.
Determine the percentage of ionic character (bond polarity) of BrCl and comment on the nature of Br-Cl bond. (Dipole moment of BrCl = 1.42 * 10^-30 cm, bond length, d_{Br-Cl} = 214 * 10^-14 m, charge of an electron = 1.6 * 10^-19 C)
An automobile tyre contains air at 320 x 10^3 Pa at 20°C. The stem valve is removed and the air is allowed to expand adiabatically against a constant external pressure of 100 x 10^3 Pa until P = P_external. For air, C_v,m = 5/2 R. Calculate the final temperature of the gas in the tyre. Assume ideal gas behaviour.
Calculate Delta G at 298 K for the formation of O3 from O2 in urban smog, where [O2] = 0.21 atm and [O3] = 5 x 10^-7 atm. Given; Delta G_f(O3) = 163 kJ mol^-1, R = 8.314 J mol^-1 K^-1, F = 96485 C mol^-1
Which one is more stable between the two isomers? Explain. [(H_3N)_5 Cr - CN - Cr(CN)_5] [(H_3N)_5 Cr - NC - Cr(CN)_5]
How will you synthesize polypropylene (PP) by using Ziegler-Natta catalysis? Discuss the mechanism and its advantages over conventional polymerization.
(i) How XeF6 can be separated from a mixture of XeF2, XeF4 and XeF6? (ii) Write the products with explanation B2H6 + 2NH3 -> ?; B2H6 + 2Me3N -> ?
For a cell reaction Cu^2+(aq) + Zn(s) -> Cu(s) + Zn^2+(aq) the standard electrode potential for Zn/Zn^2+ = 0.339 V and for Cu^2+/Cu = 0.762 V at 25°C. Calculate standard change in free energy Delta G° and equilibrium constant K for the reaction. [R = 8.314 J mol^-1 K^-1]
What is allosteric effect? Give example of an allosteric protein. Discuss homotropic allosteric modulators with examples.
Among the following compounds I and II, which has more carbonyl stretching frequency in IR spectra? Explain : [Structures I and II shown]
Calculate the lambda_max values of the following compounds : [Images of compounds (1) and (2)]
Given below are the IR and NMR spectral characteristics of three compounds : (i) IR : 1750 cm^-1; NMR : delta 2.0 (s, 3H), 5.1 (s, 2H) and 7.3 (s, 5H) (ii) IR : 1740 cm^-1; NMR : delta 3.5 (s, 3H), 3.6 (s, 2H) and 7.4 (s, 5H) (iii) IR : 3200-2800 (various bands) and 1700 cm^-1; NMR : delta 2.75 (t, 2H), 2.95 (t, 2H), 7.4 (s, 5H) and 12.0 (s, 1H) Match each of these spectral data with one of the following structures : [Structures (1) to (5) given]
Predict [A] and [B] in the following reaction : [Structure] -> NBS, CCl4 -> [A] -> NaOEt, EtOH/Delta -> [B]
Write IUPAC nomenclature of [Ni(CO)_4] and [Ni(CN)_4]^4-. Give structure and draw their shapes with explanation.
Three isomeric compounds having MF C5H10O give positive 2,4-DNP test and display the following NMR spectral characteristics. Identify the compounds. Among them, one isomeric compound on treatment with KOH (concentrated) gives two products. Write their structures also : (1) A triplet at delta 1.05 and a quartet at delta 2.47 (2) Two singlets (3) A doublet at delta 1.0, a singlet at delta 2.1 and a septet at delta 2.2
Compare and comment on the magnetic properties of the following complexes: (i) [Cu(OAc)_2]_2 (ii) [Cu(CN)_4]^3-
Determine the percentage of ionic character (bond polarity) of BrCl and comment on the nature of Br-Cl bond. (Dipole moment of BrCl = 1.42 x 10^-30 cm, bond length, d_Br-Cl = 214 x 10^-14 m, charge of an electron = 1.6 x 10^-19 C)
Write down the products obtained after photolysis of 2-methylcyclohexanone in solution phase. Explain the formation of products.
Assign the structure of the product with proper justification of kinetic aspects using energy profile diagram : Cl2HC-CF3 -> EtO- -> Product
What is meant by steady-state approximation ? How this approximation helps in deriving the kinetics of following photochemical reaction? H2(g) + Cl2(g) -> 2HCl(g) The quantum yield of this reaction is extremely large. Justify or criticize this statement.
Write down the product(s) if ortho-ester E is used instead of the compound A under the similar reaction conditions : [Image of E]
How will you convert p-nitrotoluene to m-nitrotoluene?
Write down the basic principle of polarography. With the help of a neat typical polarogram discuss the significance of halfwave potential, diffusion current and limiting current.
(1) A compound with MF C2H2BrCl exhibits two doublets (J = 16 Hz) in its PMR spectrum. Suggest a suitable structure along with other possible structures. (2) How can the structures of A and B be decided based on their UV spectral data? [max = 296 nm (epsilon_max = 10700) and lambda_max = 281 nm (epsilon_max = 20800)] [Images of structures A and B]
Out of the following list of reactants along with the reagents, identify the reaction which is not a condensation reaction. Propose a suitable mechanism for the products formed in this reaction : (i) Acetaldehyde is reacted with dilute KOH (ii) Benzaldehyde is reacted with acetic anhydride in presence of sodium acetate (iii) Benzaldehyde is reacted with malonic ester in presence of a base (iv) Benzaldehyde is reacted with concentrated KOH
Calculate \Delta G at 298 K for the formation of O3 from O2 in urban smog, where [O2] = 0.21 atm and [O3] = 5 * 10^-7 atm. Given; \Delta G_f^0 (O3) = 163 kJ mol^-1, R = 8.314 J mol^-1 K^-1, F = 96485 C mol^-1.
Consider the following atomic orbitals of A and B atoms in a heterodiatomic AB molecule A: 2s, 2px; B: 2py, 2pz. Depict the nonbonding interactions among these atomic orbitals with reason.
How will you convert p-bromonitrobenzene to m-bromobenzoic acid? Give the mechanism.
Write the reaction sequence for the synthesis of L-dopa(B), a drug for the treatment of Parkinson's disease, from L-tyrosine (A), an alpha-amino acid : [Structures of A and B given]
By using appropriate reagents and conditions, how will you convert phenol into coumarin? Give suitable mechanism for this transformation.
Predict the products in the following reactions : (i) [Reaction with Ph-substituted diene + dienophile, hv] (ii) [Reaction of triene, hv] Giving justification, write the major and minor product(s). Comment upon the chirality of recovered reactant (if any).
Why are 4f metal ions (lanthanide ions) generally pale in colour? Why do they show line like electronic spectra?
Aqueous solution of FeCl_3 is bright yellow and not pale-violet like other metal ions having high-spin d^5 configuration. Discuss the origin of the colour.
Discuss the different types of secondary structures of proteins and compare these structures with tertiary structure of proteins.
Identify the products W, X, Y and Z in the following reactions : [Reaction sequence given starting with toluene and NBS/hv]
(i) F-centre defect can be introduced in several ways. Regardless of the method used, the colour produced in any particular crystal is always same. Explain the reasons. (ii) How would the formation of F-centre affect the density of the crystal?
Cite one example of an optically active tetracoordinated complex compound where the metal ion and donor atoms lie on a plane. Justify your answer.
Aqueous solution of FeCl3 is bright yellow and not pale-violet like other metal ions having high-spin d^5 configuration. Discuss the origin of the colour.
Complete the following reaction by showing stepwise reaction mechanism for the formation of products : [Reaction with Me2C=CHMe + PhCOOOH + EtO-]
Which one is more stable between the two isomers ? Explain. [(H3N)5 Cr - CN - Cr(CN)5]; [(H3N)5 Cr - NC - Cr(CN)5]
Predict the products X and Y in the following reactions : (i) [Image of alkene] --(1) O3 / (2) H2O2--> X + Y (ii) [Image of bicyclic acid with COOH] --PBr3, Br2 (57%)--> X (iii) CH3-CH(CH3)-CH3 --Br2/hv, 127 °C--> X + Y
Complete the following reaction. Write the structures of A, B and C, and explain how IR spectroscopy is helpful to distinguish among them : [Reaction with H3C-C(OH)(CH3)... -> H+ -> A + B + C]
The compound A, acetal of acetaldehyde, on reaction with B, under given reaction conditions, yields C and the final product D : [Image showing A + B -> Propionic acid -> C -> delta -> D] Write down the structures of the products C and D. Propose a mechanism with suitable explanation.
By using the following given data, find that under what conditions is H2 in the state corresponding to N2 at (126 K and 1 atm)? Gas: H2 (T_c = 33 K, P_c = 13 atm), N2 (T_c = 126 K, P_c = 39 atm)
Identify the least stable ion of the following ions and justify your answer. OCN^-, ONC^-, SCN^-
In a certain material of simple cubic structure, (100) diffraction is obtained at \theta = 14.88° with radiation of \lambda = 1.541 Å. Can this material accommodate an atom of 1.08 Å radius interstitially in void space without lattice distortion? [Sin 14.88 = 0.257]
Give the structures of alkenes expected after dehydrohalogenation of 2-chloro-2,3-dimethylpentane by sodium ethoxide.
Given below are the IR and NMR spectral characteristics of three compounds : (i) IR : 1750 cm-1; NMR : delta 2.0 (s, 3H), 5.1 (s, 2H) and 7.3 (s, 5H) (ii) IR : 1740 cm-1; NMR : delta 3.5 (s, 3H), 3.6 (s, 2H) and 7.4 (s, 5H) (iii) IR : 3200-2800 (various bands) and 1700 cm-1; NMR : delta 2.75 (t, 2H), 2.95 (t, 2H), 7.4 (s, 5H) and 12.0 (s, 1H) Match each of these spectral data with one of the following structures : [Images of structures (1) to (5)]
In a certain material of simple cubic structure, (100) diffraction is obtained at theta = 14.88° with radiation of lambda = 1.541 Angstrom. Can this material accommodate an atom of 1.08 Angstrom radius interstitially in void space without lattice distortion? [Sin 14.88 = 0.257]
Giving justification, write the major and minor product(s). Comment upon the chirality of recovered reactant (if any).
Write the structures of the products X, Y and Z in the following reactions and indicate the mechanism for the formation of X : [Reaction sequence starting with a bicyclic diene -> (1) OsO4, pyridine -> X -> HIO4 -> Y + Z]
The reaction cis-2-butene \rightleftharpoons trans-2-butene is first order in both the direction. At 25°C, the equilibrium constant is 0.406 and the forward reaction rate constant is 4.21 * 10^-4 sec^-1. Starting with a sample of pure cis isomer with [cis]_0 = 0.115 mol dm^-3, how long it will take to form half of equilibrium amount of the trans isomer from cis isomer?
The vapour pressure of water at 363.2 K is 529 torr. Use the Clausius-Clapeyron equation to determine the average value of molar heat of vaporization, Delta H_bar, of water between 363.2 K and 373.2 K. [R = 8.314 J mol^-1 K^-1]
The rate Law for the reaction N_2O_2(g) -> 2NO(g) is of first order in the concentration of N_2O_2. Derive an expression for the time-dependent behaviour of the product concentration [NO].
(i) Calculate the number of metal-metal bond in Cp2Fe2(CO)4. (ii) Determine the structural type of the metal atom cluster, Bi3^+.
(i) Calculate the number of metal-metal bond in Cp_2Fe_2(CO)_4. (ii) Determine the structural type of the metal atom cluster, Bi_5^3+.
The compound A is optically active and upon treating A with alcoholic sodium ethoxide, it looses its optical activity. Justify : [Structure A given]
Compare average and most probable values of position of an electron in the ground state of hydrogen atom. Explain with the help of drawing, why two values differ.
The rate Law for the reaction N2O2(g) -> 2NO(g) is of first order in the concentration of N2O2. Derive an expression for the time-dependent behaviour of the product concentration [NO].
Write the major and minor products in the following reaction. Discuss the stereochemistry along with reaction mechanism for the formation of the major product : [Reaction with m-CPBA starting with Ph-CH(CH3)CH3-like system]
Predict the products in the following reactions : [Image of reaction with Ph and D2 / hv] Propose suitable mechanism to justify your answer.
Draw the active site structure of Hemocyanin (Hc) in deoxyhemocyanin and oxyhemocyanin forms, and write the colour of Hemocyanin in these two forms. Write the functions of Hemocyanin.
Write the general synthetic procedure of lower cyclosiloxanes like cyclic dimethylsiloxane trimer [(Me_2SiO)_3]. Draw its structure. Why MeSiCl_3 is not used as starting material for its synthesis?
Write the general synthetic procedure of lower cyclosiloxanes like cyclic dimethylsiloxane trimer [(Me2SiO)3]. Draw its structure. Why MeSiCl3 is not used as starting material for its synthesis?
Construct a phase-diagram for a one component system (water) and explain all the three curves. Also describe the significance of critical pressure, critical temperature and triple point.
Complete the following reaction by showing stepwise reaction mechanism for the formation of products : [Image of Me2C=CHMe + PhCOOOH / OH-] ->
What is meant by steady-state approximation? How this approximation helps in deriving the kinetics of following photochemical reaction? H_2(g) + Cl_2(g) -> 2HCl(g) The quantum yield of this reaction is extremely large. Justify or criticize this statement.
Identify the products W, X, Y and Z in the following reactions : [Image of reaction scheme involving toluene, NBS, CrO3, Ac2O, LiAlH4]
How will you distinguish among primary, secondary and tertiary alcohols on the basis of PMR spectroscopy?
What happens when the compound A is heated with one equivalent of HI ? Give the structure of the product. Justify your answer : [Structure A given]
By using appropriate reactants, reagents and conditions and using acetylene as starting material, how will you synthesise the following compound? [Structure given]